Dihydrokavain is an analytical reference standard categorized as a kavalactone.1 Dihydrokavain has analgesic and anxiolytic properties in mice and G. gallus chicks, respectively.1,2 This product is intended for research and forensic applications.
| Formal Name | (6S)-5,6-dihydro-4-methoxy-6-(2-phenylethyl)-2H-pyran-2-one |
| CAS Number | 587-63-3 |
| Molecular Formula | C₁₄H₁₆O₃ |
| Formula Weight | 232.3 |
| Purity | ≥98% |
| Formulation | A crystalline solid |
| λmax | 234 nm |
| SMILES | COC(C[C@@H]1CCC2=CC=CC=C2)=CC(O1)=O |
| InChi Key | VOOYTQRREPYRIW-LBPRGKRZSA-N |
| Storage | -20°C |
| InChi Code | InChI=1S/C14H16O3/c1-16-13-9-12(17-14(15)10-13)8-7-11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3/t12-/m0/s1 |
